Compound Q&A

Is (3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) safe?

Answer

(3-Hydroxy-4-methoxyphenyl)acetic acid
(3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) is generally considered safe for its intended uses, provided appropriate handling and storage guidelines are followed. However, it should be handled with care due to its chemical nature. Always wear appropriate personal protective equipment, such as gloves and goggles, and follow safety data sheet (SDS) recommendations.

About

CAS No 1131-94-8
English Name (3-Hydroxy-4-methoxyphenyl)acetic acid
Molecular Formula C9H10O4
Molecular Weight 182.18 g/mol
SMILES COC1=C(C=C(C=C1)CC(=O)O)O
InChIKey BWXLCOBSWMQCGP-UHFFFAOYSA-N
Last Updated: 2025-10-03 16:48

Related Q&A

Compound Q&A

What is (3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8)?

(3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) is an organic compound with the molecular fo...

Compound Q&A

What are the main uses of (3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8)?

(3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) is primarily used as a precursor in the synt...

Compound Q&A

How should (3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) be stored?

(3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) should be stored in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...