Compound Q&A

What is (3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8)?

Answer

(3-Hydroxy-4-methoxyphenyl)acetic acid
(3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) is an organic compound with the molecular formula C9H10O3. It is characterized by its hydroxy and methoxy groups, making it a phenolic acetic acid derivative. This compound is soluble in polar solvents and has a slightly bitter taste. It is commonly used in pharmaceuticals and as a food additive.

About

CAS No 1131-94-8
English Name (3-Hydroxy-4-methoxyphenyl)acetic acid
Molecular Formula C9H10O4
Molecular Weight 182.18 g/mol
SMILES COC1=C(C=C(C=C1)CC(=O)O)O
InChIKey BWXLCOBSWMQCGP-UHFFFAOYSA-N
Last Updated: 2025-10-03 16:48

Related Q&A

Compound Q&A

What are the main uses of (3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8)?

(3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) is primarily used as a precursor in the synt...

Compound Q&A

Is (3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) safe?

(3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) is generally considered safe for its intende...

Compound Q&A

How should (3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) be stored?

(3-Hydroxy-4-methoxyphenyl)acetic acid (CAS: 1131-94-8) should be stored in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...