Compound Q&A

How should 2-Methyl-2-proanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate (CAS: 166815-96-9) be stored?

Answer

2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate
This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and air exposure. Proper storage conditions are essential to maintain its stability and prevent degradation.

About

English Name 2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate
Molecular Formula C18H27NO5S
Molecular Weight 369.48 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC2CCN(CC2)C(=O)OC(C)(C)C
InChIKey DARTVAOOTJKHQW-UHFFFAOYSA-N
Last Updated: 2025-10-03 16:47

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate (CAS: 166815-96-9)?

2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate is a complex o...

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate (CAS: 166815-96-9)?

The main uses of this compound include its application in pharmaceuticals, particularly in the devel...

Compound Q&A

Is 2-Methyl-2-proanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate (CAS: 166815-96-9) safe?

Safety of this compound depends on handling and exposure. It is generally considered safe when handl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...