Compound Q&A

Is 2-Methyl-2-proanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate (CAS: 166815-96-9) safe?

Answer

2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate
Safety of this compound depends on handling and exposure. It is generally considered safe when handled properly with appropriate protective measures, such as gloves and safety glasses. However, it should be stored away from heat and direct sunlight to prevent degradation.

About

English Name 2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate
Molecular Formula C18H27NO5S
Molecular Weight 369.48 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC2CCN(CC2)C(=O)OC(C)(C)C
InChIKey DARTVAOOTJKHQW-UHFFFAOYSA-N
Last Updated: 2025-10-03 16:47

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate (CAS: 166815-96-9)?

2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate is a complex o...

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate (CAS: 166815-96-9)?

The main uses of this compound include its application in pharmaceuticals, particularly in the devel...

Compound Q&A

How should 2-Methyl-2-proanyl 4-({[(4-methylphenyl)sulfonyl]oxy}methyl)-1-piperidinecarboxylate (CAS: 166815-96-9) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...