Compound Q&A

Are there alternatives to Omecamtiv mecarbil (CAS: 873697-71-3) in synthesis?

Answer

Omecamtiv mecarbil
There are several alternatives to Omecamtiv mecarbil (CAS: 873697-71-3) in synthesis, such as isomers and analogs like omecamtiv mecarbil propionate, which can be used based on specific synthetic requirements. Common alternative reagents include various catalysts and solvents that can facilitate the synthesis process with different efficiency and selectivity.

About

English Name Omecamtiv mecarbil
Molecular Formula C20H24FN5O3
Molecular Weight 401.43 g/mol
SMILES COC(=O)N1CCN(CC1)Cc1cccc(c1F)NC(=O)Nc1ccc(nc1)C
InChIKey RFUBTTPMWSKEIW-UHFFFAOYSA-N
Last Updated: 2025-10-02 18:41

Related Q&A

Compound Q&A

What regulatory guidelines apply to Omecamtiv mecarbil (CAS: 873697-71-3)?

Omecamtiv mecarbil (CAS: 873697-71-3) falls under various regulatory guidelines, including GHS class...

Compound Q&A

What is the market or research trend for Omecamtiv mecarbil (CAS: 873697-71-3)?

The market for Omecamtiv mecarbil (CAS: 873697-71-3) is growing due to its potential as a cardiac co...

Compound Q&A

How should waste containing Omecamtiv mecarbil (CAS: 873697-71-3) be handled?

Waste containing Omecamtiv mecarbil (CAS: 873697-71-3) should be handled by collecting it in appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...