Compound Q&A

How is 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8) typically synthesized?

Answer

4-(Hexyloxy)benzoic acid
4-(Hexyloxy)benzoic acid is typically synthesized via the esterification of hexanol with benzoic acid. Commonly, this is achieved under mild conditions using an acid catalyst such as sulfuric acid. The yield is usually good, with high selectivity towards the desired product.

About

CAS No 1142-39-8
English Name 4-(Hexyloxy)benzoic acid
Molecular Formula C13H18O3
Molecular Weight 222.28 g/mol
SMILES CCCCCCOC1=CC=C(C=C1)C(=O)O
InChIKey HBQUXMZZODHFMJ-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8)?

4-(Hexyloxy)benzoic acid (CAS: 1142-39-8) is a white solid with a crystalline form. It has a molecul...

Compound Q&A

What industries use 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8)?

4-(Hexyloxy)benzoic acid (CAS: 1142-39-8) finds applications in the pharmaceutical industry, where i...

Compound Q&A

What precautions should be taken when handling 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8)?

When handling 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8), always wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...