Compound Q&A

What are the physical and chemical properties of 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8)?

Answer

4-(Hexyloxy)benzoic acid
4-(Hexyloxy)benzoic acid (CAS: 1142-39-8) is a white solid with a crystalline form. It has a molecular weight of approximately 220.19 g/mol. Soluble in ethanol and slightly soluble in water. It is relatively stable but can undergo hydrolysis in the presence of water and acid.

About

CAS No 1142-39-8
English Name 4-(Hexyloxy)benzoic acid
Molecular Formula C13H18O3
Molecular Weight 222.28 g/mol
SMILES CCCCCCOC1=CC=C(C=C1)C(=O)O
InChIKey HBQUXMZZODHFMJ-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8) typically synthesized?

4-(Hexyloxy)benzoic acid is typically synthesized via the esterification of hexanol with benzoic aci...

Compound Q&A

What industries use 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8)?

4-(Hexyloxy)benzoic acid (CAS: 1142-39-8) finds applications in the pharmaceutical industry, where i...

Compound Q&A

What precautions should be taken when handling 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8)?

When handling 4-(Hexyloxy)benzoic acid (CAS: 1142-39-8), always wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...