Compound Q&A

What precautions should be taken when handling N-Acetyl-D-phenylalanine (CAS: 10172-89-1)?

Answer

N-Acetyl-D-phenylalanine
Handling N-Acetyl-D-phenylalanine requires appropriate personal protective equipment (PPE), including gloves, safety goggles, and lab coat. It should be stored in a cool, dry place away from moisture and strong acids or bases. In the event of a spill, use appropriate spill kits and follow safety data sheet (SDS) guidelines for disposal. Always work in a well-ventilated area or fume hood to minimize inhalation exposure.

About

CAS No 10172-89-1
English Name N-Acetyl-D-phenylalanine
Molecular Formula C11H13NO3
Molecular Weight 207.23 g/mol
SMILES CC(=O)NC(CC1=CC=CC=C1)C(=O)O
InChIKey CBQJSKKFNMDLON-SNVBAGLBSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Acetyl-D-phenylalanine (CAS: 10172-89-1)?

N-Acetyl-D-phenylalanine is a white crystalline solid with a molecular weight of approximately 221.2...

Compound Q&A

How is N-Acetyl-D-phenylalanine (CAS: 10172-89-1) typically synthesized?

N-Acetyl-D-phenylalanine is typically synthesized by acetylation of D-phenylalanine using acetic anh...

Compound Q&A

What industries use N-Acetyl-D-phenylalanine (CAS: 10172-89-1)?

N-Acetyl-D-phenylalanine is used in various industries, including pharmaceuticals, where it serves a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...