Compound Q&A

What industries use 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS: 50446-44-1)?

Answer

4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid
4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid finds applications in the pharmaceutical industry as a precursor for drug synthesis, in the polymer industry for the development of high-performance polymers, and in the electronics industry for use in sensor technology and semiconductor manufacturing. Its unique structure provides valuable reactivity for various chemical modifications and functionalization processes.

About

CAS No 50446-44-1
English Name 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid
Molecular Formula C27H18O6
Molecular Weight 438.44 g/mol
SMILES O=C(C1=CC=C(C2=CC(C3=CC=C(C(O)=O)C=C3)=CC(C4=CC=C(C(O)=O)C=C4)=C2)C=C1)O
InChIKey SATWKVZGMWCXOJ-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS: 50446-44-1)?

4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS: 50446-44-1) typically synthesized?

4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid is typically synthesized through a multistep process ...

Compound Q&A

What precautions should be taken when handling 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS: 50446-44-1)?

When handling 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid, it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...