Compound Q&A

How is 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS: 50446-44-1) typically synthesized?

Answer

4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid
4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid is typically synthesized through a multistep process involving the coupling of 4-carboxybenzoic acid with 3,5-dibromobenzophenone. The synthesis involves the formation of an aryl coupling intermediate followed by the introduction of carboxylic acid groups. The reaction is carried out under mild conditions using catalytic amounts of palladium(II) acetate and triphenylphosphine as a ligand. The overall yield is around 70-80%.

About

CAS No 50446-44-1
English Name 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid
Molecular Formula C27H18O6
Molecular Weight 438.44 g/mol
SMILES O=C(C1=CC=C(C2=CC(C3=CC=C(C(O)=O)C=C3)=CC(C4=CC=C(C(O)=O)C=C4)=C2)C=C1)O
InChIKey SATWKVZGMWCXOJ-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS: 50446-44-1)?

4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS: 50446-44-1)?

4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid finds applications in the pharmaceutical industry as ...

Compound Q&A

What precautions should be taken when handling 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid (CAS: 50446-44-1)?

When handling 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid, it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...