Compound Q&A

How is pentafluorobenzoyl chloride (CAS: 2251-50-5) typically synthesized?

Answer

Pentafluorobenzoyl chloride
Pentafluorobenzoyl chloride is typically synthesized by the reaction of pentafluorobenzoyl bromide with hydrogen chloride. This synthesis can occur under mild conditions, but catalysts such as aluminum chloride are often used to improve yield and selectivity. The process usually involves refluxing the mixture to promote reaction completion.

About

CAS No 2251-50-5
English Name Pentafluorobenzoyl chloride
Molecular Formula C7ClF5O
Molecular Weight 230.52 g/mol
SMILES C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)Cl
InChIKey MYHOHFDYWMPGJY-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentafluorobenzoyl chloride (CAS: 2251-50-5)?

Pentafluorobenzoyl chloride is a colorless to pale yellow liquid with a molecular weight of approxim...

Compound Q&A

What industries use pentafluorobenzoyl chloride (CAS: 2251-50-5)?

Pentafluorobenzoyl chloride is used in various industries, including pharmaceuticals for the synthes...

Compound Q&A

What precautions should be taken when handling pentafluorobenzoyl chloride (CAS: 2251-50-5)?

Handling pentafluorobenzoyl chloride requires strict precautions due to its reactivity. It should be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...