Compound Q&A

What are the physical and chemical properties of Pentafluorobenzoyl chloride (CAS: 2251-50-5)?

Answer

Pentafluorobenzoyl chloride
Pentafluorobenzoyl chloride is a colorless to pale yellow liquid with a molecular weight of approximately 243.01 g/mol. It is highly soluble in organic solvents but is only slightly soluble in water. Chemically, it is highly reactive, acting as a strong electrophile and capable of forming various fluorinated compounds under certain conditions.

About

CAS No 2251-50-5
English Name Pentafluorobenzoyl chloride
Molecular Formula C7ClF5O
Molecular Weight 230.52 g/mol
SMILES C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)Cl
InChIKey MYHOHFDYWMPGJY-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is pentafluorobenzoyl chloride (CAS: 2251-50-5) typically synthesized?

Pentafluorobenzoyl chloride is typically synthesized by the reaction of pentafluorobenzoyl bromide w...

Compound Q&A

What industries use pentafluorobenzoyl chloride (CAS: 2251-50-5)?

Pentafluorobenzoyl chloride is used in various industries, including pharmaceuticals for the synthes...

Compound Q&A

What precautions should be taken when handling pentafluorobenzoyl chloride (CAS: 2251-50-5)?

Handling pentafluorobenzoyl chloride requires strict precautions due to its reactivity. It should be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...