Compound Q&A

How is (2S)-2-amino-3-(4-bromophenyl)propanoic acid (CAS: 24250-84-8) typically synthesized?

Answer

(2S)-2-amino-3-(4-bromophenyl)propanoic acid
(2S)-2-amino-3-(4-bromophenyl)propanoic acid (CAS: 24250-84-8) is typically synthesized by bromination of 2-amino-3-phenylpropanoic acid followed by coupling with bromobenzene. Common synthetic methods include the use of N-bromosuccinimide (NBS) as a brominating agent under UV light, and the reaction is carried out in a suitable organic solvent such as dichloromethane. The yield is generally high, around 70-80%, and the reaction is selective and provides good purity.

About

CAS No 24250-84-8
English Name (2S)-2-amino-3-(4-bromophenyl)propanoic acid
Molecular Formula C9H10BrNO2
Molecular Weight 244.09 g/mol
SMILES C1=CC(=CC=C1CC(C(=O)O)N)Br
InChIKey PEMUHKUIQHFMTH-QMMMGPOBSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-amino-3-(4-bromophenyl)propanoic acid (CAS: 24250-84-8)?

(2S)-2-amino-3-(4-bromophenyl)propanoic acid (CAS: 24250-84-8) is a white crystalline solid with a m...

Compound Q&A

What industries use (2S)-2-amino-3-(4-bromophenyl)propanoic acid (CAS: 24250-84-8)?

(2S)-2-amino-3-(4-bromophenyl)propanoic acid (CAS: 24250-84-8) is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling (2S)-2-amino-3-(4-bromophenyl)propanoic acid (CAS: 24250-84-8)?

When handling (2S)-2-amino-3-(4-bromophenyl)propanoic acid (CAS: 24250-84-8), proper personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...