Compound Q&A

What precautions should be taken when handling 6-Bromo-4-quinolinol (CAS: 145369-94-4)?

Answer

6-Bromo-4-quinolinol
When handling 6-Bromo-4-quinolinol (CAS: 145369-94-4), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to avoid inhalation. Spills should be cleaned up using appropriate materials, and the area should be thoroughly washed. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name 6-Bromo-4-quinolinol
Molecular Formula C9H6BrNO
Molecular Weight 224.06 g/mol
SMILES C1=CC2=C(C=C1Br)C(=O)C=CN2
InChIKey XKLBNOHKHRAXKK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-4-quinolinol (CAS: 145369-94-4)?

6-Bromo-4-quinolinol (CAS: 145369-94-4) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is 6-Bromo-4-quinolinol (CAS: 145369-94-4) typically synthesized?

6-Bromo-4-quinolinol (CAS: 145369-94-4) is typically synthesized via a bromination reaction of 4-qui...

Compound Q&A

What industries use 6-Bromo-4-quinolinol (CAS: 145369-94-4)?

6-Bromo-4-quinolinol (CAS: 145369-94-4) is primarily used in the pharmaceutical industry as an inter...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...