Compound Q&A

What are the physical and chemical properties of 6-Bromo-4-quinolinol (CAS: 145369-94-4)?

Answer

6-Bromo-4-quinolinol
6-Bromo-4-quinolinol (CAS: 145369-94-4) is a crystalline compound with a molecular weight of approximately 220.03 g/mol. It has a pKa of about 7.4 in aqueous solution and is slightly soluble in water. The compound is relatively stable in air but can be reactive towards strong oxidizing agents. It is a key intermediate in the synthesis of various pharmaceuticals and can be used in organic reactions.

About

English Name 6-Bromo-4-quinolinol
Molecular Formula C9H6BrNO
Molecular Weight 224.06 g/mol
SMILES C1=CC2=C(C=C1Br)C(=O)C=CN2
InChIKey XKLBNOHKHRAXKK-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is 6-Bromo-4-quinolinol (CAS: 145369-94-4) typically synthesized?

6-Bromo-4-quinolinol (CAS: 145369-94-4) is typically synthesized via a bromination reaction of 4-qui...

Compound Q&A

What industries use 6-Bromo-4-quinolinol (CAS: 145369-94-4)?

6-Bromo-4-quinolinol (CAS: 145369-94-4) is primarily used in the pharmaceutical industry as an inter...

Compound Q&A

What precautions should be taken when handling 6-Bromo-4-quinolinol (CAS: 145369-94-4)?

When handling 6-Bromo-4-quinolinol (CAS: 145369-94-4), it is essential to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...