Compound Q&A

How is 4-(4-Methyl-1-piperazinyl)benzoic acid (CAS: 86620-62-4) typically synthesized?

Answer

4-(4-Methyl-1-piperazinyl)benzoic acid
4-(4-Methyl-1-piperazinyl)benzoic acid is usually synthesized via the reaction of 4-aminobenzoic acid with 4-methylpiperazine in the presence of a condensing agent like 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide (EDC) and N-hydroxysuccinimide (NHS). The yield is typically around 85-90%, and the reaction is carried out under anhydrous conditions to avoid side reactions.

About

CAS No 86620-62-4
English Name 4-(4-Methyl-1-piperazinyl)benzoic acid
Molecular Formula C12H16N2O2
Molecular Weight 220.27 g/mol
SMILES CN1CCN(CC1)c2ccc(cc2)C(=O)O
InChIKey UCFZVQHKTRSZMM-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Methyl-1-piperazinyl)benzoic acid (CAS: 86620-62-4)?

4-(4-Methyl-1-piperazinyl)benzoic acid is a white crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 4-(4-Methyl-1-piperazinyl)benzoic acid (CAS: 86620-62-4)?

4-(4-Methyl-1-piperazinyl)benzoic acid is primarily used in the pharmaceutical and cosmetic industri...

Compound Q&A

What precautions should be taken when handling 4-(4-Methyl-1-piperazinyl)benzoic acid (CAS: 86620-62-4)?

When handling 4-(4-Methyl-1-piperazinyl)benzoic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...