Compound Q&A

What are the physical and chemical properties of 4-(4-Methyl-1-piperazinyl)benzoic acid (CAS: 86620-62-4)?

Answer

4-(4-Methyl-1-piperazinyl)benzoic acid
4-(4-Methyl-1-piperazinyl)benzoic acid is a white crystalline solid with a molecular weight of approximately 277.36 g/mol. It has a pKa of around 4.0 and is poorly soluble in water but soluble in organic solvents like methanol and dichloromethane. This compound is reactive with strong bases and can undergo esterification and amide formation reactions.

About

CAS No 86620-62-4
English Name 4-(4-Methyl-1-piperazinyl)benzoic acid
Molecular Formula C12H16N2O2
Molecular Weight 220.27 g/mol
SMILES CN1CCN(CC1)c2ccc(cc2)C(=O)O
InChIKey UCFZVQHKTRSZMM-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is 4-(4-Methyl-1-piperazinyl)benzoic acid (CAS: 86620-62-4) typically synthesized?

4-(4-Methyl-1-piperazinyl)benzoic acid is usually synthesized via the reaction of 4-aminobenzoic aci...

Compound Q&A

What industries use 4-(4-Methyl-1-piperazinyl)benzoic acid (CAS: 86620-62-4)?

4-(4-Methyl-1-piperazinyl)benzoic acid is primarily used in the pharmaceutical and cosmetic industri...

Compound Q&A

What precautions should be taken when handling 4-(4-Methyl-1-piperazinyl)benzoic acid (CAS: 86620-62-4)?

When handling 4-(4-Methyl-1-piperazinyl)benzoic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...