Compound Q&A

What precautions should be taken when handling 3,7-Diethyl-4,6-nonanedione (CAS: 872802-98-7)?

Answer

3,7-Diethyl-4,6-nonanedione
When handling 3,7-Diethyl-4,6-nonanedione, wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Ensure the use of a fume hood during handling to prevent inhalation. Store the compound in a cool, dry place away from direct sunlight and heat sources. In case of a spill, clean up using proper spill response procedures and consult the Safety Data Sheet (SDS) for further guidance.

About

English Name 3,7-Diethyl-4,6-nonanedione
Molecular Formula C13H24O2
Molecular Weight 212.33 g/mol
SMILES CCC(CC)C(CC(C(CC)CC)=O)=O
InChIKey MFELLNQJMHCAKI-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,7-Diethyl-4,6-nonanedione (CAS: 872802-98-7)?

3,7-Diethyl-4,6-nonanedione is a colorless to pale yellow liquid with a molecular weight of approxim...

Compound Q&A

How is 3,7-Diethyl-4,6-nonanedione (CAS: 872802-98-7) typically synthesized?

3,7-Diethyl-4,6-nonanedione is synthesized via the acetoacetic ester condensation of ethyl acetoacet...

Compound Q&A

What industries use 3,7-Diethyl-4,6-nonanedione (CAS: 872802-98-7)?

3,7-Diethyl-4,6-nonanedione is used in the pharmaceutical industry for the synthesis of certain drug...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...