Compound Q&A

What industries use 3,7-Diethyl-4,6-nonanedione (CAS: 872802-98-7)?

Answer

3,7-Diethyl-4,6-nonanedione
3,7-Diethyl-4,6-nonanedione is used in the pharmaceutical industry for the synthesis of certain drugs. It is also employed in the polymer industry to improve the performance of certain polymers. Additionally, it has applications in the fragrance and flavor industry due to its pleasant odor. This compound can also be used in the development of sensors and as a precursor in semiconductor technology.

About

English Name 3,7-Diethyl-4,6-nonanedione
Molecular Formula C13H24O2
Molecular Weight 212.33 g/mol
SMILES CCC(CC)C(CC(C(CC)CC)=O)=O
InChIKey MFELLNQJMHCAKI-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,7-Diethyl-4,6-nonanedione (CAS: 872802-98-7)?

3,7-Diethyl-4,6-nonanedione is a colorless to pale yellow liquid with a molecular weight of approxim...

Compound Q&A

How is 3,7-Diethyl-4,6-nonanedione (CAS: 872802-98-7) typically synthesized?

3,7-Diethyl-4,6-nonanedione is synthesized via the acetoacetic ester condensation of ethyl acetoacet...

Compound Q&A

What precautions should be taken when handling 3,7-Diethyl-4,6-nonanedione (CAS: 872802-98-7)?

When handling 3,7-Diethyl-4,6-nonanedione, wear appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...