Compound Q&A

What precautions should be taken when handling 20(R)-Ginsenoside Rg2 (CAS: 80952-72-3)?

Answer

20(R)-Ginsenoside Rg2
When handling 20(R)-Ginsenoside Rg2, use appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. Store the compound in a cool, dry place away from direct sunlight. In case of a spill, clean up immediately using appropriate safety protocols and consult the Safety Data Sheet (SDS) for detailed guidance.

About

CAS No 80952-72-3
English Name 20(R)-Ginsenoside Rg2
Molecular Formula C42H72O13
Molecular Weight 785.01 g/mol
SMILES OCC1OC(OC2CC3(C)C(C4(C2C(C)(C)C(O)CC4)C)CC(C2C3(C)CCC2C(CCC=C(C)C)(O)C)O)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O
InChIKey AGBCLJAHARWNLA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 20(R)-Ginsenoside Rg2 (CAS: 80952-72-3)?

20(R)-Ginsenoside Rg2 is a crystalline compound with a molecular weight of approximately 618.84 g/mo...

Compound Q&A

How is 20(R)-Ginsenoside Rg2 (CAS: 80952-72-3) typically synthesized?

20(R)-Ginsenoside Rg2 is synthesized through chemical modification of ginsenoside Rg3. The process i...

Compound Q&A

What industries use 20(R)-Ginsenoside Rg2 (CAS: 80952-72-3)?

20(R)-Ginsenoside Rg2 is primarily used in the pharmaceutical industry for its potential health bene...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...