Compound Q&A

What industries use N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6)?

Answer

N,N,N-Trimethyl(phenyl)methanaminium iodide
N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6) is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry for modifying properties of polymers and in the semiconductor industry for etching processes. Additionally, it finds applications in sensors and other advanced materials.

About

CAS No 4525-46-6
English Name N,N,N-Trimethyl(phenyl)methanaminium iodide
Molecular Formula C10H16IN
Molecular Weight 277.14 g/mol
SMILES C[N+](C)(C)CC1=CC=CC=C1.[I-]
InChIKey LRRJQNMXIDXNIM-UHFFFAOYSA-M
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6)?

N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6) is a crystalline solid with a molecular...

Compound Q&A

How is N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6) typically synthesized?

N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6) is synthesized by the reaction of pheny...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6)?

When handling N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6), ensure proper personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...