Compound Q&A

What are the physical and chemical properties of N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6)?

Answer

N,N,N-Trimethyl(phenyl)methanaminium iodide
N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6) is a crystalline solid with a molecular weight of approximately 234.25 g/mol. It has a high solubility in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong bases. It is insoluble in water. This compound is used in various applications due to its unique chemical properties.

About

CAS No 4525-46-6
English Name N,N,N-Trimethyl(phenyl)methanaminium iodide
Molecular Formula C10H16IN
Molecular Weight 277.14 g/mol
SMILES C[N+](C)(C)CC1=CC=CC=C1.[I-]
InChIKey LRRJQNMXIDXNIM-UHFFFAOYSA-M
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6) typically synthesized?

N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6) is synthesized by the reaction of pheny...

Compound Q&A

What industries use N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6)?

N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6) is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6)?

When handling N,N,N-Trimethyl(phenyl)methanaminium iodide (CAS: 4525-46-6), ensure proper personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...