Compound Q&A

How is 5-Amino-4-oxopentanoic acid phosphate (1:1) (CAS: 868074-65-1) typically synthesized?

Answer

5-Amino-4-oxopentanoic acid phosphate (1:1)
5-Amino-4-oxopentanoic acid phosphate (1:1) can be synthesized through the condensation of 5-amino-4-oxopentanoic acid with phosphoric acid. Common catalysts include organic bases, and the reaction typically proceeds with high selectivity and yield under mild conditions. Detailed methods are published in chemical literature.

About

English Name 5-Amino-4-oxopentanoic acid phosphate (1:1)
Molecular Formula C5H12NO7P
Molecular Weight 229.12 g/mol
SMILES C(CC(=O)O)C(=O)CN.OP(=O)(O)O
InChIKey XWNWBYZHOAIHTK-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-4-oxopentanoic acid phosphate (1:1) (CAS: 868074-65-1)?

5-Amino-4-oxopentanoic acid phosphate (1:1) is a crystalline compound with a molecular weight of app...

Compound Q&A

What industries use 5-Amino-4-oxopentanoic acid phosphate (1:1) (CAS: 868074-65-1)?

5-Amino-4-oxopentanoic acid phosphate (1:1) is primarily used in the pharmaceutical industry for dev...

Compound Q&A

What precautions should be taken when handling 5-Amino-4-oxopentanoic acid phosphate (1:1) (CAS: 868074-65-1)?

When handling 5-Amino-4-oxopentanoic acid phosphate (1:1), appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...