Compound Q&A

What are the physical and chemical properties of 5-Amino-4-oxopentanoic acid phosphate (1:1) (CAS: 868074-65-1)?

Answer

5-Amino-4-oxopentanoic acid phosphate (1:1)
5-Amino-4-oxopentanoic acid phosphate (1:1) is a crystalline compound with a molecular weight of approximately 295.18 g/mol. It has a solubility of about 2.5 g/L in water at 25°C. This compound is relatively stable under normal conditions but can react with strong bases. It is often used in biochemical research and pharmaceuticals.

About

English Name 5-Amino-4-oxopentanoic acid phosphate (1:1)
Molecular Formula C5H12NO7P
Molecular Weight 229.12 g/mol
SMILES C(CC(=O)O)C(=O)CN.OP(=O)(O)O
InChIKey XWNWBYZHOAIHTK-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 5-Amino-4-oxopentanoic acid phosphate (1:1) (CAS: 868074-65-1) typically synthesized?

5-Amino-4-oxopentanoic acid phosphate (1:1) can be synthesized through the condensation of 5-amino-4...

Compound Q&A

What industries use 5-Amino-4-oxopentanoic acid phosphate (1:1) (CAS: 868074-65-1)?

5-Amino-4-oxopentanoic acid phosphate (1:1) is primarily used in the pharmaceutical industry for dev...

Compound Q&A

What precautions should be taken when handling 5-Amino-4-oxopentanoic acid phosphate (1:1) (CAS: 868074-65-1)?

When handling 5-Amino-4-oxopentanoic acid phosphate (1:1), appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...