Compound Q&A

What industries use N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2)?

Answer

N,N,N-Triethylethanaminium hexafluorophosphate
N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2) is widely used in the pharmaceutical industry for drug synthesis and as a solvent in peptide synthesis. It is also used in the polymer industry as a room-temperature ionic liquid for polymerization reactions. Additionally, it finds applications in sensors and as a reagent in semiconductor processing.

About

CAS No 429-07-2
English Name N,N,N-Triethylethanaminium hexafluorophosphate
Molecular Formula C8H20F6NP
Molecular Weight 275.22 g/mol
SMILES CC[N+](CC)(CC)CC.F[P-](F)(F)(F)(F)F
InChIKey KLKUOIXSIDDDCN-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2)?

N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2) is an ionic liquid with a crystalline...

Compound Q&A

How is N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2) typically synthesized?

N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2) is typically synthesized by reacting ...

Compound Q&A

What precautions should be taken when handling N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2)?

When handling N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...