Compound Q&A

How is N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2) typically synthesized?

Answer

N,N,N-Triethylethanaminium hexafluorophosphate
N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2) is typically synthesized by reacting triethylamine with hexafluorophosphoric acid. The reaction involves the formation of triethylammonium hexafluorophosphate, followed by the proton transfer to form the final product. This method provides good yield and selectivity, and can be conducted under mild conditions.

About

CAS No 429-07-2
English Name N,N,N-Triethylethanaminium hexafluorophosphate
Molecular Formula C8H20F6NP
Molecular Weight 275.22 g/mol
SMILES CC[N+](CC)(CC)CC.F[P-](F)(F)(F)(F)F
InChIKey KLKUOIXSIDDDCN-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2)?

N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2) is an ionic liquid with a crystalline...

Compound Q&A

What industries use N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2)?

N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2) is widely used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2)?

When handling N,N,N-Triethylethanaminium hexafluorophosphate (CAS: 429-07-2), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...