Compound Q&A

What are the physical and chemical properties of 2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate (CAS: 16432-81-8)?

Answer

2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate
2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate (CAS: 16432-81-8) is a colorless to pale yellow liquid with a molecular weight of approximately 296.3 g/mol. It has a pKa of about 4.5 and is poorly soluble in water but highly soluble in organic solvents such as ethanol and acetone. This compound exhibits moderate reactivity, particularly in ester and acrylate functionalities, making it suitable for polymerization and other chemical reactions.

About

CAS No 16432-81-8
English Name 2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate
Molecular Formula C18H16O5
Molecular Weight 312.32 g/mol
SMILES C=CC(=O)OCCOC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O
InChIKey NMMXJQKTXREVGN-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate (CAS: 16432-81-8) typically synthesized?

2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate (CAS: 16432-81-8) is synthesized through the condensati...

Compound Q&A

What industries use 2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate (CAS: 16432-81-8)?

2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate (CAS: 16432-81-8) is primarily used in the polymer indu...

Compound Q&A

What precautions should be taken when handling 2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate (CAS: 16432-81-8)?

When handling 2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate (CAS: 16432-81-8), it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...