Compound Q&A

What industries use Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4)?

Answer

Methyl 6-fluoro-1H-indole-4-carboxylate
Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4) is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It is also utilized in the chemical industry for developing new materials and in research applications for its unique chemical properties.

About

English Name Methyl 6-fluoro-1H-indole-4-carboxylate
Molecular Formula C10H8FNO2
Molecular Weight 193.18 g/mol
SMILES COC(=O)c1cc(cc2c1cc[nH]2)F
InChIKey CKFPLBCOOZCPOR-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4)?

Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4) is a crystalline solid with a molecular ...

Compound Q&A

How is Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4) typically synthesized?

Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4) can be synthesized through a multi-step ...

Compound Q&A

What precautions should be taken when handling Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4)?

When handling Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4), it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...