Compound Q&A

What are the physical and chemical properties of Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4)?

Answer

Methyl 6-fluoro-1H-indole-4-carboxylate
Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4) is a crystalline solid with a molecular weight of around 194.18 g/mol. It has a low solubility in water but is soluble in common organic solvents like methanol and dichloromethane. This compound is known for its stability under basic conditions but can be reactive under acidic conditions. It is often used in organic synthesis due to its functional groups.

About

English Name Methyl 6-fluoro-1H-indole-4-carboxylate
Molecular Formula C10H8FNO2
Molecular Weight 193.18 g/mol
SMILES COC(=O)c1cc(cc2c1cc[nH]2)F
InChIKey CKFPLBCOOZCPOR-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4) typically synthesized?

Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4) can be synthesized through a multi-step ...

Compound Q&A

What industries use Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4)?

Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4)?

When handling Methyl 6-fluoro-1H-indole-4-carboxylate (CAS: 1082040-43-4), it is crucial to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...