Compound Q&A

How is 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2) typically synthesized?

Answer

1,2,3,4,5-Pentabromo-6-methylbenzene
1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2) is typically synthesized through a bromination process. The synthesis usually involves the bromination of 6-methylbenzene using bromine in the presence of a Lewis acid catalyst such as aluminum bromide. The reaction is carried out in an inert solvent, and the yield can be improved by controlling the reaction conditions. The process is selective and yields a pure product.

About

CAS No 87-83-2
English Name 1,2,3,4,5-Pentabromo-6-methylbenzene
Molecular Formula C7H3Br5
Molecular Weight 486.62 g/mol
SMILES Cc1c(c(c(c(c1Br)Br)Br)Br)Br
InChIKey OZHJEQVYCBTHJT-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2)?

1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2) is a solid with a crystalline form. It has a mol...

Compound Q&A

What industries use 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2)?

1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2) is used in various industries. It is commonly fo...

Compound Q&A

What precautions should be taken when handling 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2)?

When handling 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2), it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...