Compound Q&A

What are the physical and chemical properties of 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2)?

Answer

1,2,3,4,5-Pentabromo-6-methylbenzene
1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2) is a solid with a crystalline form. It has a molecular weight of approximately 370.16 g/mol. This compound is poorly soluble in water but soluble in organic solvents. It is not highly reactive under normal conditions but can undergo bromination reactions under specific conditions. It has a high melting point and low volatility, making it suitable for various industrial applications.

About

CAS No 87-83-2
English Name 1,2,3,4,5-Pentabromo-6-methylbenzene
Molecular Formula C7H3Br5
Molecular Weight 486.62 g/mol
SMILES Cc1c(c(c(c(c1Br)Br)Br)Br)Br
InChIKey OZHJEQVYCBTHJT-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2) typically synthesized?

1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2) is typically synthesized through a bromination p...

Compound Q&A

What industries use 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2)?

1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2) is used in various industries. It is commonly fo...

Compound Q&A

What precautions should be taken when handling 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2)?

When handling 1,2,3,4,5-Pentabromo-6-methylbenzene (CAS: 87-83-2), it is crucial to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...