Compound Q&A

What industries use 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid (CAS: 85559-46-2)?

Answer

4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid
4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid is primarily used in the pharmaceutical and chemical industries for its reactive diazo group. It is also utilized in the development of sensors and semiconductors due to its unique chemical properties and reactivity.

About

CAS No 85559-46-2
English Name 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid
Molecular Formula C9H5F3N2O2
Molecular Weight 230.14 g/mol
SMILES c1cc(ccc1C(=O)O)C2(N=N2)C(F)(F)F
InChIKey CZPAJVBVULSLGG-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid (CAS: 85559-46-2)?

4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid is a crystalline solid with a molecular weight ...

Compound Q&A

How is 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid (CAS: 85559-46-2) typically synthesized?

4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid is typically synthesized through a diazo coupli...

Compound Q&A

What precautions should be taken when handling 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid (CAS: 85559-46-2)?

When handling 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...