Compound Q&A

How is 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid (CAS: 85559-46-2) typically synthesized?

Answer

4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid
4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid is typically synthesized through a diazo coupling reaction involving trifluoromethyl azide and benzoic acid. The reaction is typically catalyzed by a Lewis acid like aluminum trichloride or titanium(IV) isopropoxide. The yield can be optimized by controlling the reaction temperature and time.

About

CAS No 85559-46-2
English Name 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid
Molecular Formula C9H5F3N2O2
Molecular Weight 230.14 g/mol
SMILES c1cc(ccc1C(=O)O)C2(N=N2)C(F)(F)F
InChIKey CZPAJVBVULSLGG-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid (CAS: 85559-46-2)?

4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid is a crystalline solid with a molecular weight ...

Compound Q&A

What industries use 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid (CAS: 85559-46-2)?

4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid is primarily used in the pharmaceutical and che...

Compound Q&A

What precautions should be taken when handling 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid (CAS: 85559-46-2)?

When handling 4-[3-(Trifluoromethyl)-3H-diaziren-3-yl]benzoic acid, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...