Compound Q&A

How is 4-Nitrocinnamic acid (CAS: 619-89-6) typically synthesized?

Answer

4-Nitrocinnamic acid
4-Nitrocinnamic acid (CAS: 619-89-6) is typically synthesized by nitration of cinnamic acid in the presence of a catalyst like concentrated sulfuric acid. The nitration reaction is exothermic and should be performed in a well-ventilated environment with temperature control. The yield is around 75-80%, and the purity can be enhanced through recrystallization.

About

CAS No 619-89-6
English Name 4-Nitrocinnamic acid
Molecular Formula C9H7NO4
Molecular Weight 193.16 g/mol
SMILES C1=CC(=CC=C1C=CC(=O)O)[N+](=O)[O-]
InChIKey XMMRNCHTDONGRJ-ZZXKWVIFSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitrocinnamic acid (CAS: 619-89-6)?

4-Nitrocinnamic acid (CAS: 619-89-6) is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use 4-Nitrocinnamic acid (CAS: 619-89-6)?

4-Nitrocinnamic acid (CAS: 619-89-6) finds applications in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 4-Nitrocinnamic acid (CAS: 619-89-6)?

When handling 4-Nitrocinnamic acid (CAS: 619-89-6), wear appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...