Compound Q&A

What are the physical and chemical properties of 4-Nitrocinnamic acid (CAS: 619-89-6)?

Answer

4-Nitrocinnamic acid
4-Nitrocinnamic acid (CAS: 619-89-6) is a white crystalline solid with a molecular weight of approximately 192.08 g/mol. It is sparingly soluble in water but soluble in common organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong bases to form the corresponding salt. It has a melting point of about 235-238°C.

About

CAS No 619-89-6
English Name 4-Nitrocinnamic acid
Molecular Formula C9H7NO4
Molecular Weight 193.16 g/mol
SMILES C1=CC(=CC=C1C=CC(=O)O)[N+](=O)[O-]
InChIKey XMMRNCHTDONGRJ-ZZXKWVIFSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 4-Nitrocinnamic acid (CAS: 619-89-6) typically synthesized?

4-Nitrocinnamic acid (CAS: 619-89-6) is typically synthesized by nitration of cinnamic acid in the p...

Compound Q&A

What industries use 4-Nitrocinnamic acid (CAS: 619-89-6)?

4-Nitrocinnamic acid (CAS: 619-89-6) finds applications in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 4-Nitrocinnamic acid (CAS: 619-89-6)?

When handling 4-Nitrocinnamic acid (CAS: 619-89-6), wear appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...