Compound Q&A

What are the physical and chemical properties of Amprenavir (CAS: 161814-49-9)?

Answer

Amprenavir
Amprenavir is a crystalline compound with a molecular weight of 448.39 g/mol. It has a high solubility in aqueous solutions and exhibits basic properties due to its amine group. Amprenavir is relatively stable under normal conditions but shows reactivity towards strong oxidizing agents. It is insoluble in organic solvents like chloroform and methanol.

About

English Name Amprenavir
Molecular Formula C25H35N3O6S
Molecular Weight 505.64 g/mol
SMILES CC(C)CN(CC(C(CC1=CC=CC=C1)NC(=O)OC2CCOC2)O)S(=O)(=O)C3=CC=C(C=C3)N
InChIKey YMARZQAQMVYCKC-OEMFJLHTSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Amprenavir (CAS: 161814-49-9) typically synthesized?

Amprenavir is synthesized through a multi-step process involving the condensation of a 3,4-dihydroxy...

Compound Q&A

What industries use Amprenavir (CAS: 161814-49-9)?

Amprenavir is primarily used in the pharmaceutical industry, specifically in the treatment of HIV/AI...

Compound Q&A

What precautions should be taken when handling Amprenavir (CAS: 161814-49-9)?

Amprenavir should be handled in a well-ventilated area or fume hood due to its basic nature. Wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...