Compound Q&A

What precautions should be taken when handling Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4)?

Answer

Amino(3-bromophenyl)acetic acid
When handling Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4), appropriate personal protective equipment (PPE) should be used, including gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from heat sources. Fume hoods should be used when performing the synthesis or handling the compound to minimize exposure. In case of a spill, it should be cleaned up immediately using appropriate absorbent materials. For detailed safety information, refer to the Safety Data Sheet (SDS).

About

CAS No 79422-73-4
English Name Amino(3-bromophenyl)acetic acid
Molecular Formula C8H8BrNO2
Molecular Weight 230.06 g/mol
SMILES C1=CC(=CC(=C1)Br)C(C(=O)O)N
InChIKey MJPMYLPJAVQUQA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4)?

Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4) is a crystalline solid with a molecular weight of ...

Compound Q&A

How is Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4) typically synthesized?

Amino(3-bromophenyl)acetic acid is typically synthesized by the reaction of 3-bromophenylacetic acid...

Compound Q&A

What industries use Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4)?

Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4) is used in various industries, including pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...