Compound Q&A

What are the physical and chemical properties of Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4)?

Answer

Amino(3-bromophenyl)acetic acid
Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4) is a crystalline solid with a molecular weight of approximately 267.01 g/mol. It has a low solubility in water (0.3 g/100 mL at 20°C) and is slightly soluble in ethanol. The compound is reactive towards nucleophiles and can undergo various chemical transformations. It exhibits basic properties due to the amino group.

About

CAS No 79422-73-4
English Name Amino(3-bromophenyl)acetic acid
Molecular Formula C8H8BrNO2
Molecular Weight 230.06 g/mol
SMILES C1=CC(=CC(=C1)Br)C(C(=O)O)N
InChIKey MJPMYLPJAVQUQA-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4) typically synthesized?

Amino(3-bromophenyl)acetic acid is typically synthesized by the reaction of 3-bromophenylacetic acid...

Compound Q&A

What industries use Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4)?

Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4) is used in various industries, including pharmaceu...

Compound Q&A

What precautions should be taken when handling Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4)?

When handling Amino(3-bromophenyl)acetic acid (CAS: 79422-73-4), appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...