Compound Q&A

What precautions should be taken when handling Micafungin (CAS: 235114-32-6)?

Answer

Micafungin (DISCONTINUED)
When handling Micafungin, proper personal protective equipment (PPE) such as gloves, lab coats, and safety glasses should be worn to avoid skin and eye contact. Work should be conducted in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up immediately using appropriate methods, and the Material Safety Data Sheet (MSDS) should be consulted for specific handling and disposal instructions.

About

English Name Micafungin (DISCONTINUED)
Molecular Formula C56H71N9O23S
Molecular Weight 1270.29 g/mol
SMILES CCCCCOC1=CC=C(C=C1)C2=CC(=NO2)C3=CC=C(C=C3)C(=O)NC4CC(C(NC(=O)C5C(C(CN5C(=O)C(NC(=O)C(NC(=O)C6CC(CN6C(=O)C(NC4=O)C(C)O)O)C(C(C7=CC(=C(C=C7)O)OS(=O)(=O)O)O)O)C(CC(=O)N)O)C)O)O)O
InChIKey PIEUQSKUWLMALL-YABMTYFHSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Micafungin (CAS: 235114-32-6)?

Micafungin is a polyene antifungal agent with a molecular weight of approximately 543.68 g/mol. It h...

Compound Q&A

How is Micafungin (CAS: 235114-32-6) typically synthesized?

Micafungin is typically synthesized through a complex multistep process involving fermentation, chem...

Compound Q&A

What industries use Micafungin (CAS: 235114-32-6)?

Micafungin is used primarily in the pharmaceutical industry for the treatment of fungal infections. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...