Compound Q&A

What are the physical and chemical properties of Micafungin (CAS: 235114-32-6)?

Answer

Micafungin (DISCONTINUED)
Micafungin is a polyene antifungal agent with a molecular weight of approximately 543.68 g/mol. It has a crystalline form with a melting point of about 260-264°C. Micafungin is poorly soluble in water but soluble in most organic solvents. Chemically, it is known for its stability and low reactivity under normal conditions, with no significant chemical reactions observed under typical storage conditions.

About

English Name Micafungin (DISCONTINUED)
Molecular Formula C56H71N9O23S
Molecular Weight 1270.29 g/mol
SMILES CCCCCOC1=CC=C(C=C1)C2=CC(=NO2)C3=CC=C(C=C3)C(=O)NC4CC(C(NC(=O)C5C(C(CN5C(=O)C(NC(=O)C(NC(=O)C6CC(CN6C(=O)C(NC4=O)C(C)O)O)C(C(C7=CC(=C(C=C7)O)OS(=O)(=O)O)O)O)C(CC(=O)N)O)C)O)O)O
InChIKey PIEUQSKUWLMALL-YABMTYFHSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Micafungin (CAS: 235114-32-6) typically synthesized?

Micafungin is typically synthesized through a complex multistep process involving fermentation, chem...

Compound Q&A

What industries use Micafungin (CAS: 235114-32-6)?

Micafungin is used primarily in the pharmaceutical industry for the treatment of fungal infections. ...

Compound Q&A

What precautions should be taken when handling Micafungin (CAS: 235114-32-6)?

When handling Micafungin, proper personal protective equipment (PPE) such as gloves, lab coats, and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...