Compound Q&A

What are the physical and chemical properties of 2-Chloro-1-(3-chlorophenyl)ethanone (CAS: 21886-56-6)?

Answer

2-Chloro-1-(3-chlorophenyl)ethanone
2-Chloro-1-(3-chlorophenyl)ethanone (CAS: 21886-56-6) is a white crystalline solid with a molecular weight of approximately 212.03 g/mol. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. This compound is relatively stable under normal conditions but can undergo hydrolysis and chlorination under acidic or basic conditions. It is used in various chemical processes and has a pKa of around 6.5.

About

CAS No 21886-56-6
English Name 2-Chloro-1-(3-chlorophenyl)ethanone
Molecular Formula C8H6Cl2O
Molecular Weight 189.04 g/mol
SMILES C1=CC(=CC(=C1)Cl)C(=O)CCl
InChIKey AVUVSYIYUADCKE-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 2-Chloro-1-(3-chlorophenyl)ethanone (CAS: 21886-56-6) typically synthesized?

2-Chloro-1-(3-chlorophenyl)ethanone (CAS: 21886-56-6) can be synthesized via the acylation of 3-chlo...

Compound Q&A

What industries use 2-Chloro-1-(3-chlorophenyl)ethanone (CAS: 21886-56-6)?

2-Chloro-1-(3-chlorophenyl)ethanone (CAS: 21886-56-6) is primarily used in the pharmaceutical and fi...

Compound Q&A

What precautions should be taken when handling 2-Chloro-1-(3-chlorophenyl)ethanone (CAS: 21886-56-6)?

When handling 2-Chloro-1-(3-chlorophenyl)ethanone (CAS: 21886-56-6), it is essential to use proper P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...