Compound Q&A

What industries use 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CAS: 869494-16-6)?

Answer

2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate
2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate is used in the pharmaceutical industry, particularly in the synthesis of certain drugs. It may also find applications in the polymer industry for functionalization of polymers and in sensor technology for its unique chemical reactivity. Its specific use in semiconductors is less common but possible in specialized applications.

About

English Name 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate
Molecular Formula C10H18N2O2
Molecular Weight 198.27 g/mol
SMILES CC(C)(C)OC(=O)N1C2CC1CNC2
InChIKey OUFBVDKNEWUFHP-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CAS: 869494-16-6)?

2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate is a white crystalline solid with a...

Compound Q&A

How is 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CAS: 869494-16-6) typically synthesized?

2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate is typically synthesized via an ami...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CAS: 869494-16-6)?

When handling 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate, it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...