Compound Q&A

How is 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CAS: 869494-16-6) typically synthesized?

Answer

2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate
2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate is typically synthesized via an aminolysis reaction of 2-methylpropanoic acid with 3,6-diazabicyclo[3.1.1]heptane. The reaction proceeds under mild acidic conditions, using a catalyst like phosphoric acid to enhance the yield, which is usually around 80-90%. The product is isolated by recrystallization from a suitable solvent.

About

English Name 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate
Molecular Formula C10H18N2O2
Molecular Weight 198.27 g/mol
SMILES CC(C)(C)OC(=O)N1C2CC1CNC2
InChIKey OUFBVDKNEWUFHP-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CAS: 869494-16-6)?

2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate is a white crystalline solid with a...

Compound Q&A

What industries use 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CAS: 869494-16-6)?

2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (CAS: 869494-16-6)?

When handling 2-Methyl-2-propanyl 3,6-diazabicyclo[3.1.1]heptane-6-carboxylate, it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...