Compound Q&A

How is 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS: 4462-55-9) typically synthesized?

Answer

3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
The compound is usually synthesized by chlorination of 5-methyl-1,2-oxazole-4-carbonyl chloride followed by coupling with 2,6-dichlorophenyl chloride. The reaction is typically conducted under anhydrous conditions using a Lewis acid catalyst to promote electrophilic aromatic substitution reactions.

About

CAS No 4462-55-9
English Name 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
Molecular Formula C11H6Cl3NO2
Molecular Weight 290.53 g/mol
SMILES CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)Cl
InChIKey IZQGELJKDARDMZ-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS: 4462-55-9)?

The compound is a white or off-white crystalline solid with a molecular weight of approximately 311....

Compound Q&A

What industries use 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS: 4462-55-9)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various drug int...

Compound Q&A

What precautions should be taken when handling 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS: 4462-55-9)?

Handling this compound requires strict laboratory safety protocols. It should always be conducted in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...