Compound Q&A

What are the physical and chemical properties of 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS: 4462-55-9)?

Answer

3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
The compound is a white or off-white crystalline solid with a molecular weight of approximately 311.04 g/mol. It has a low solubility in water but good solubility in organic solvents such as ethanol and acetone. Chemically, it is highly reactive, particularly towards nucleophiles and bases. It can form stable adducts and derivatives under mild conditions.

About

CAS No 4462-55-9
English Name 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride
Molecular Formula C11H6Cl3NO2
Molecular Weight 290.53 g/mol
SMILES CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)Cl
InChIKey IZQGELJKDARDMZ-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS: 4462-55-9) typically synthesized?

The compound is usually synthesized by chlorination of 5-methyl-1,2-oxazole-4-carbonyl chloride foll...

Compound Q&A

What industries use 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS: 4462-55-9)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various drug int...

Compound Q&A

What precautions should be taken when handling 3-(2,6-Dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS: 4462-55-9)?

Handling this compound requires strict laboratory safety protocols. It should always be conducted in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...