Compound Q&A

What is (2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine (CAS: 848821-58-9)?

Answer

(2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine
(2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine is a chiral organic compound with a unique structure that includes a pyrrolidine ring, a silyl ether group, and phenyl substituents. It is characterized by its high boiling point and low solubility in water. This compound is primarily used in medicinal chemistry and as a precursor in synthetic organic reactions.

About

English Name (2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine
Molecular Formula C20H27NOSi
Molecular Weight 325.53 g/mol
SMILES C[Si](OC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1)(C)C
InChIKey RSUHWMSTWSSNOW-IBGZPJMESA-N
Last Updated: 2025-10-01 00:17

Related Q&A

Compound Q&A

What are the main uses of (2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine (CAS: 848821-58-9)?

(2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine (CAS: 848821-58-9) is mainly used as a synth...

Compound Q&A

Is (2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine (CAS: 848821-58-9) safe?

Yes, (2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine (CAS: 848821-58-9) is considered safe u...

Compound Q&A

How should (2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine (CAS: 848821-58-9) be stored?

(2S)-2-{Diphenyl[(trimethylsilyl)oxy]methyl}pyrrolidine (CAS: 848821-58-9) should be stored in a coo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...