Compound Q&A

What are the main uses of 3-(2-Bromophenyl)propanoic acid (CAS: 15115-58-9)?

Answer

3-(2-Bromophenyl)propanoic acid
3-(2-Bromophenyl)propanoic acid is primarily used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It is also utilized in the formulation of some industrial and research applications due to its specific chemical properties.

About

CAS No 15115-58-9
English Name 3-(2-Bromophenyl)propanoic acid
Molecular Formula C9H9BrO2
Molecular Weight 229.07 g/mol
SMILES C1=CC=C(C(=C1)CCC(=O)O)Br
InChIKey AOACQJFIGWNQBC-UHFFFAOYSA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What is 3-(2-Bromophenyl)propanoic acid (CAS: 15115-58-9)?

3-(2-Bromophenyl)propanoic acid is an organic compound with the CAS number 15115-58-9. It is a white...

Compound Q&A

Is 3-(2-Bromophenyl)propanoic acid (CAS: 15115-58-9) safe?

3-(2-Bromophenyl)propanoic acid is generally considered safe under proper handling conditions. Howev...

Compound Q&A

How should 3-(2-Bromophenyl)propanoic acid (CAS: 15115-58-9) be stored?

3-(2-Bromophenyl)propanoic acid should be stored in a cool, dry place, protected from light and heat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...