Compound Q&A

What is 3-(2-Bromophenyl)propanoic acid (CAS: 15115-58-9)?

Answer

3-(2-Bromophenyl)propanoic acid
3-(2-Bromophenyl)propanoic acid is an organic compound with the CAS number 15115-58-9. It is a white to off-white solid with a molecular weight of approximately 212.02 g/mol. This compound is characterized by its aromatic and brominated structure, which gives it unique reactivity and solubility properties.

About

CAS No 15115-58-9
English Name 3-(2-Bromophenyl)propanoic acid
Molecular Formula C9H9BrO2
Molecular Weight 229.07 g/mol
SMILES C1=CC=C(C(=C1)CCC(=O)O)Br
InChIKey AOACQJFIGWNQBC-UHFFFAOYSA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What are the main uses of 3-(2-Bromophenyl)propanoic acid (CAS: 15115-58-9)?

3-(2-Bromophenyl)propanoic acid is primarily used as an intermediate in the synthesis of various pha...

Compound Q&A

Is 3-(2-Bromophenyl)propanoic acid (CAS: 15115-58-9) safe?

3-(2-Bromophenyl)propanoic acid is generally considered safe under proper handling conditions. Howev...

Compound Q&A

How should 3-(2-Bromophenyl)propanoic acid (CAS: 15115-58-9) be stored?

3-(2-Bromophenyl)propanoic acid should be stored in a cool, dry place, protected from light and heat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...