Compound Q&A

How should Solithromycin (CAS: 760981-83-7) be stored?

Answer

Solithromycin
Solithromycin (CAS: 760981-83-7) should be stored at room temperature, between 15°C and 30°C (59°F and 86°F). Keep the medication away from direct sunlight and moisture. Store it in a tightly sealed container to protect it from light and humidity. Do not freeze the medication. Follow your pharmacist's instructions for proper storage to ensure its efficacy and safety.

About

English Name Solithromycin
Molecular Formula C43H65FN6O10
Molecular Weight 845.02 g/mol
SMILES CC[C@@H]1[C@@]2([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H](C(=O)[C@](C(=O)O1)(C)F)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)OC)C)C)N(C(=O)O2)CCCCn4cc(nn4)c5cccc(c5)N)C
InChIKey IXXFZUPTQVDPPK-ZAWHAJPISA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What is Solithromycin (CAS: 760981-83-7)?

Solithromycin (CAS: 760981-83-7) is a macrolide antibiotic. It has a chemical structure similar to o...

Compound Q&A

What are the main uses of Solithromycin (CAS: 760981-83-7)?

Solithromycin (CAS: 760981-83-7) is primarily used for the treatment of respiratory tract infections...

Compound Q&A

Is Solithromycin (CAS: 760981-83-7) safe?

Solithromycin (CAS: 760981-83-7) is generally considered safe when used as directed. However, it may...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...