Compound Q&A

What are the main uses of Solithromycin (CAS: 760981-83-7)?

Answer

Solithromycin
Solithromycin (CAS: 760981-83-7) is primarily used for the treatment of respiratory tract infections, including pneumonia, bronchitis, and sinusitis. It is also effective against certain gram-negative bacteria, making it a valuable alternative to other antibiotics in some cases.

About

English Name Solithromycin
Molecular Formula C43H65FN6O10
Molecular Weight 845.02 g/mol
SMILES CC[C@@H]1[C@@]2([C@@H]([C@H](C(=O)[C@@H](C[C@@]([C@@H]([C@H](C(=O)[C@](C(=O)O1)(C)F)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)OC)C)C)N(C(=O)O2)CCCCn4cc(nn4)c5cccc(c5)N)C
InChIKey IXXFZUPTQVDPPK-ZAWHAJPISA-N
Last Updated: 2025-09-30 08:42

Related Q&A

Compound Q&A

What is Solithromycin (CAS: 760981-83-7)?

Solithromycin (CAS: 760981-83-7) is a macrolide antibiotic. It has a chemical structure similar to o...

Compound Q&A

Is Solithromycin (CAS: 760981-83-7) safe?

Solithromycin (CAS: 760981-83-7) is generally considered safe when used as directed. However, it may...

Compound Q&A

How should Solithromycin (CAS: 760981-83-7) be stored?

Solithromycin (CAS: 760981-83-7) should be stored at room temperature, between 15°C and 30°C (59°F a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...